CAS 127142-69-2 appears in our catalog under these names: 2,3,4-Trichlorophenyl isothiocyanate, 95%, 2,3,4–Trichlorophenyl isothiocyanate, 2,3,4-Trichlorophenyl isothiocyanate, 98%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g.
1,2,3-trichloro-4-isothiocyanatobenzene (CAS 127142-69-2) is a chemical compound with the molecular formula C7H2Cl3NS and a molecular weight of 238.5 g/mol. IUPAC name: 1,2,3-trichloro-4-isothiocyanatobenzene. InChIKey: NUAGIDXAYVLNEG-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NS |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 1,2,3-trichloro-4-isothiocyanatobenzene |
| InChIKey | NUAGIDXAYVLNEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N=C=S)Cl)Cl)Cl |
Computed by PubChem (NCBI)