CAS 22134-07-2 appears in our catalog under these names: 2,4,6-Trichlorophenylisothiocyanate 98+%, 2,4,6-Trichlorophenyl isothiocyanate, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g.
1,3,5-trichloro-2-isothiocyanatobenzene (CAS 22134-07-2) is a chemical compound with the molecular formula C7H2Cl3NS and a molecular weight of 238.5 g/mol. IUPAC name: 1,3,5-trichloro-2-isothiocyanatobenzene. InChIKey: DSXVZIOQROMOEF-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NS |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 1,3,5-trichloro-2-isothiocyanatobenzene |
| InChIKey | DSXVZIOQROMOEF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N=C=S)Cl)Cl |
Computed by PubChem (NCBI)