CAS 2476729-57-2 appears in our catalog under these names: 3,5,7-Trichlorothieno[3,2-b]pyridine 98%, 3,5,7-Trichlorothieno[3,2-b]pyridine, 95%, 95%, 3,5,7-Trichlorothieno[3,2-b]pyridine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
3,5,7-trichlorothieno[3,2-b]pyridine (CAS 2476729-57-2) is a chemical compound with the molecular formula C7H2Cl3NS and a molecular weight of 238.5 g/mol. IUPAC name: 3,5,7-trichlorothieno[3,2-b]pyridine. InChIKey: NICFXLUOWKFSRW-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NS |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 3,5,7-trichlorothieno[3,2-b]pyridine |
| InChIKey | NICFXLUOWKFSRW-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=CS2)Cl)N=C1Cl)Cl |
Computed by PubChem (NCBI)