CAS 35754-32-6 is the registry number for 1,2,3-Trichloro-5-isothiocyanatobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3-trichloro-5-isothiocyanatobenzene (CAS 35754-32-6) is a chemical compound with the molecular formula C7H2Cl3NS and a molecular weight of 238.5 g/mol. IUPAC name: 1,2,3-trichloro-5-isothiocyanatobenzene. InChIKey: PNJQKOWOBUEEAQ-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NS |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 1,2,3-trichloro-5-isothiocyanatobenzene |
| InChIKey | PNJQKOWOBUEEAQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)Cl)Cl)N=C=S |
Computed by PubChem (NCBI)