CAS 1203544-02-8 appears in our catalog under these names: 2-Oxo-1-(propan-2-yl)-1,2-dihydropyridine-4-carboxylic acid, 95%, 1-Isopropyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid, 98%, 2-Oxo-1-(propan-2-yl)-1,2-dihydropyridine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
2-oxo-1-propan-2-ylpyridine-4-carboxylic acid (CAS 1203544-02-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-oxo-1-propan-2-ylpyridine-4-carboxylic acid. InChIKey: FRMULVSYTSBJHX-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-oxo-1-propan-2-ylpyridine-4-carboxylic acid |
| InChIKey | FRMULVSYTSBJHX-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=CC(=CC1=O)C(=O)O |
Computed by PubChem (NCBI)