CAS 1203655-71-3 appears in our catalog under these names: (R)–4–(1–Aminoethyl)benzenesulfonamide hydrochloride, (R)-4-(1-Aminoethyl)benzenesulfonamide hydrochloride, 97%, 97%, (R)-4-(1-AMINOETHYL)BENZENESULFONAMIDE HYDROCHLORIDE, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25mg, 5g, 50mg, 100mg, 250mg, 1g.
4-[(1R)-1-aminoethyl]benzenesulfonamide;hydrochloride (CAS 1203655-71-3) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: 4-[(1R)-1-aminoethyl]benzenesulfonamide;hydrochloride. InChIKey: KBEDWXLKBDLBEQ-FYZOBXCZSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 4-[(1R)-1-aminoethyl]benzenesulfonamide;hydrochloride |
| InChIKey | KBEDWXLKBDLBEQ-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)S(=O)(=O)N)N.Cl |
Computed by PubChem (NCBI)