Products 1203683-19-5
CAS 1203683-19-5 is the registry number for 3-(2,5-Difluorophenyl)piperidine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
3-(2,5-difluorophenyl)piperidine;hydrochloride (CAS 1203683-19-5) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: 3-(2,5-difluorophenyl)piperidine;hydrochloride. InChIKey: QZCTTYCNHDCTGY-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)piperidine;hydrochloride |
| InChIKey | QZCTTYCNHDCTGY-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=C(C=CC(=C2)F)F.Cl |
Computed by PubChem (NCBI)