CAS 1203953-08-5 is the registry number for Dimethyl 2-Fluoro-5-methylterephthalate, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
Dimethyl 2-fluoro-5-methylbenzene-1,4-dicarboxylate (CAS 1203953-08-5) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: dimethyl 2-fluoro-5-methylbenzene-1,4-dicarboxylate. InChIKey: VLWQVKMFPSUFIR-UHFFFAOYSA-N.
| Molecular formula | C11H11FO4 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | dimethyl 2-fluoro-5-methylbenzene-1,4-dicarboxylate |
| InChIKey | VLWQVKMFPSUFIR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)OC)F)C(=O)OC |
Computed by PubChem (NCBI)