Products 1823714-16-4

CAS 1823714-16-4 is the registry number for 6-Fluoro-8-methoxychromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-fluoro-8-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1823714-16-4) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: 6-fluoro-8-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: MMUZXYNPOORPLE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11FO4
Molecular weight226.20 g/mol
IUPAC name6-fluoro-8-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyMMUZXYNPOORPLE-UHFFFAOYSA-N
SMILESCOC1=CC(=CC2=C1OCC(C2)C(=O)O)F

Computed by PubChem (NCBI)