Products 1226233-97-1

CAS 1226233-97-1 is the registry number for Methyl 5'-fluoro-2'-methoxybenzoylacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(5-fluoro-2-methoxyphenyl)-3-oxopropanoate (CAS 1226233-97-1) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: methyl 3-(5-fluoro-2-methoxyphenyl)-3-oxopropanoate. InChIKey: FGOBBRCAZWBYNX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11FO4
Molecular weight226.20 g/mol
IUPAC namemethyl 3-(5-fluoro-2-methoxyphenyl)-3-oxopropanoate
InChIKeyFGOBBRCAZWBYNX-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)F)C(=O)CC(=O)OC

Computed by PubChem (NCBI)