CAS 1226233-97-1 is the registry number for Methyl 5'-fluoro-2'-methoxybenzoylacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
Methyl 3-(5-fluoro-2-methoxyphenyl)-3-oxopropanoate (CAS 1226233-97-1) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: methyl 3-(5-fluoro-2-methoxyphenyl)-3-oxopropanoate. InChIKey: FGOBBRCAZWBYNX-UHFFFAOYSA-N.
| Molecular formula | C11H11FO4 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | methyl 3-(5-fluoro-2-methoxyphenyl)-3-oxopropanoate |
| InChIKey | FGOBBRCAZWBYNX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)F)C(=O)CC(=O)OC |
Computed by PubChem (NCBI)