Products 170483-01-9

CAS 170483-01-9 is the registry number for 8-Fluoro-5-methoxychromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

8-fluoro-5-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 170483-01-9) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: 8-fluoro-5-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: UONNRNZUBGZPCX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11FO4
Molecular weight226.20 g/mol
IUPAC name8-fluoro-5-methoxy-3,4-dihydro-2H-chromene-3-carboxylic acid
InChIKeyUONNRNZUBGZPCX-UHFFFAOYSA-N
SMILESCOC1=C2CC(COC2=C(C=C1)F)C(=O)O

Computed by PubChem (NCBI)