CAS 347-63-7 appears in our catalog under these names: 3-(3-Fluoro-4-methoxybenzoyl)propionic acid, 98%, 4-(3-Fluoro-4-methoxyphenyl)-4-oxobutanoic acid, 98%, 3-(3-Fluoro-4-methoxybenzoyl)propionic acid, 3-Fluoro-4-methoxy-γ-oxobenzenebutanoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 10g, 5g, 2g, 25g.
4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid (CAS 347-63-7) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: 4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid. InChIKey: SNRFVYKMDZSFED-UHFFFAOYSA-N.
| Molecular formula | C11H11FO4 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
| InChIKey | SNRFVYKMDZSFED-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CCC(=O)O)F |
Computed by PubChem (NCBI)