Products 1268121-69-2
CAS 1268121-69-2 appears in our catalog under these names: 2–(4–Fluorobenzyl)succinic acid, 2-(4-Fluorobenzyl)succinic acid, 95%, 2-(4-Fluorobenzyl)succinic acid 95%, 2-(4-Fluorobenzyl)succinic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat. Available pack sizes: 50mg, 250mg, 1g, 100mg.
2-[(4-fluorophenyl)methyl]butanedioic acid (CAS 1268121-69-2) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: 2-[(4-fluorophenyl)methyl]butanedioic acid. InChIKey: FOCYAYIEXHRVJD-UHFFFAOYSA-N.
| Molecular formula | C11H11FO4 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)methyl]butanedioic acid |
| InChIKey | FOCYAYIEXHRVJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(CC(=O)O)C(=O)O)F |
Computed by PubChem (NCBI)