CAS 948840-09-3 appears in our catalog under these names: 3-[2-Fluoro-4-(methoxycarbonyl)phenyl]propanoic acid, 95%, 3-(2-Fluoro-4-(methoxycarbonyl)phenyl)propanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
3-(2-fluoro-4-methoxycarbonylphenyl)propanoic acid (CAS 948840-09-3) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: 3-(2-fluoro-4-methoxycarbonylphenyl)propanoic acid. InChIKey: OTUNGZDTFAZHPU-UHFFFAOYSA-N.
| Molecular formula | C11H11FO4 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 3-(2-fluoro-4-methoxycarbonylphenyl)propanoic acid |
| InChIKey | OTUNGZDTFAZHPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)CCC(=O)O)F |
Computed by PubChem (NCBI)