CAS 1204-36-0 appears in our catalog under these names: 1-(3-Hydroxyphenyl)pyrrolidine-2,5-dione, 98%, 1-(3-Hydroxyphenyl)pyrrolidine-2,5-dione, 1-(3-Hydroxyphenyl)-2,5-pyrrolidinedione, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
1-(3-hydroxyphenyl)pyrrolidine-2,5-dione (CAS 1204-36-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 1-(3-hydroxyphenyl)pyrrolidine-2,5-dione. InChIKey: JKQLQZKMBVUJCI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1-(3-hydroxyphenyl)pyrrolidine-2,5-dione |
| InChIKey | JKQLQZKMBVUJCI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)