CAS 1204475-73-9 is the registry number for 3-Methyl-1H-pyrrolo(2,3-b)pyridine-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 5g.
3-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS 1204475-73-9) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 3-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid. InChIKey: NKNGCIHADLXOBA-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| InChIKey | NKNGCIHADLXOBA-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)