Products 1206971-05-2
CAS 1206971-05-2 appears in our catalog under these names: 6-Bromo-2-indolizinecarboxylic acid, 6-Bromoindolizine-2-carboxylic acid, 95%, 6-Bromo-2-indolizinecarboxylic acid 97%, 6-BROMOINDOLIZINE-2-CARBOXYLIC ACID, 97%, 6-Bromoindolizine-2-carboxylic acid, 97%, 97%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 50mg.
6-bromoindolizine-2-carboxylic acid (CAS 1206971-05-2) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 6-bromoindolizine-2-carboxylic acid. InChIKey: NJTWQSPKHQNJPH-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 6-bromoindolizine-2-carboxylic acid |
| InChIKey | NJTWQSPKHQNJPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN2C1=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)