CAS 1207961-50-9 appears in our catalog under these names: B-(4-Chloro-2-hydroxy-6-methylphenyl)boronic Acid, 4-Chloro-2-hydroxy-6-methylphenylboronic acid, (4-Chloro-2-hydroxy-6-methylphenyl)boronic acid 97%, B-(4-Chloro-2-hydroxy-6-methylphenyl)boronic acid, 97%, 97%, (4-CHLORO-2-HYDROXY-6-METHYLPHENYL)BORONIC ACID, 98%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 0,5g, 50mg, 250mg, 1g, 5g.
(4-chloro-2-hydroxy-6-methylphenyl)boronic acid (CAS 1207961-50-9) is a chemical compound with the molecular formula C7H8BClO3 and a molecular weight of 186.40 g/mol. IUPAC name: (4-chloro-2-hydroxy-6-methylphenyl)boronic acid. InChIKey: CBPRFVJXGNVYLO-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO3 |
|---|---|
| Molecular weight | 186.40 g/mol |
| IUPAC name | (4-chloro-2-hydroxy-6-methylphenyl)boronic acid |
| InChIKey | CBPRFVJXGNVYLO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)Cl)O)(O)O |
Computed by PubChem (NCBI)