CAS 1208074-91-2 appears in our catalog under these names: 2-Ethoxy-3-nitrotoluene, 98%, 2-Ethoxy-1-Methyl-3-nitrobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
2-ethoxy-1-methyl-3-nitrobenzene (CAS 1208074-91-2) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-ethoxy-1-methyl-3-nitrobenzene. InChIKey: BZFRQLCKEVHCTC-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-ethoxy-1-methyl-3-nitrobenzene |
| InChIKey | BZFRQLCKEVHCTC-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC=C1[N+](=O)[O-])C |
Computed by PubChem (NCBI)