CAS 120924-81-4 appears in our catalog under these names: (1R)-1-(4-Phenylphenyl)ethan-1-ol, 95%, (1R)-1-(4-phenylphenyl)ethan-1-ol, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
(1R)-1-(4-phenylphenyl)ethanol (CAS 120924-81-4) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: (1R)-1-(4-phenylphenyl)ethanol. InChIKey: GOISDOCZKZYADO-LLVKDONJSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | (1R)-1-(4-phenylphenyl)ethanol |
| InChIKey | GOISDOCZKZYADO-LLVKDONJSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)