CAS 121004-86-2 is the registry number for 4-(3,4-Dichlorophenyl)-1,2-dihydrophthalazin-1-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-(3,4-dichlorophenyl)-2H-phthalazin-1-one (CAS 121004-86-2) is a chemical compound with the molecular formula C14H8Cl2N2O and a molecular weight of 291.1 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-2H-phthalazin-1-one. InChIKey: GKHJJRRZTWDZJO-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N2O |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-2H-phthalazin-1-one |
| InChIKey | GKHJJRRZTWDZJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)