Products 23441-87-4
CAS 23441-87-4 is the registry number for 6-Chloro-4-(2-chlorophenyl)-2(1H)-quinazolinone. Offered by: Mikromol, LoGiCal. Available pack sizes: 25mg, 100mg, 10mg.
6-chloro-4-(2-chlorophenyl)-1H-quinazolin-2-one (CAS 23441-87-4) is a chemical compound with the molecular formula C14H8Cl2N2O and a molecular weight of 291.1 g/mol. IUPAC name: 6-chloro-4-(2-chlorophenyl)-1H-quinazolin-2-one. InChIKey: FIKXZQLWVRAQOA-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N2O |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 6-chloro-4-(2-chlorophenyl)-1H-quinazolin-2-one |
| InChIKey | FIKXZQLWVRAQOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=O)NC3=C2C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)