Products 83800-90-2
CAS 83800-90-2 is the registry number for Apoptosis inducer 40. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,3-dichlorophenyl)-3H-quinazolin-4-one (CAS 83800-90-2) is a chemical compound with the molecular formula C14H8Cl2N2O and a molecular weight of 291.1 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-3H-quinazolin-4-one. InChIKey: YONQDFCKZCGPSD-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N2O |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)-3H-quinazolin-4-one |
| InChIKey | YONQDFCKZCGPSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)C3=C(C(=CC=C3)Cl)Cl |
Computed by PubChem (NCBI)