CAS 62682-01-3 is the registry number for 2-(2,4-Dichlorophenyl)-5-phenyl-1,3,4-oxadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dichlorophenyl)-5-phenyl-1,3,4-oxadiazole (CAS 62682-01-3) is a chemical compound with the molecular formula C14H8Cl2N2O and a molecular weight of 291.1 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-5-phenyl-1,3,4-oxadiazole. InChIKey: CCNNEJPCNXRSQA-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N2O |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-5-phenyl-1,3,4-oxadiazole |
| InChIKey | CCNNEJPCNXRSQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(O2)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)