Products 352346-46-4
CAS 352346-46-4 is the registry number for AHR activator 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole (CAS 352346-46-4) is a chemical compound with the molecular formula C14H8Cl2N2O and a molecular weight of 291.1 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole. InChIKey: WMJVJVBCUBCALD-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N2O |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-3-phenyl-1,2,4-oxadiazole |
| InChIKey | WMJVJVBCUBCALD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)