Products 31797-22-5
CAS 31797-22-5 is the registry number for 2,6-Dichloro-3-phenylquinazolin-4(3H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dichloro-3-phenylquinazolin-4-one (CAS 31797-22-5) is a chemical compound with the molecular formula C14H8Cl2N2O and a molecular weight of 291.1 g/mol. IUPAC name: 2,6-dichloro-3-phenylquinazolin-4-one. InChIKey: HFWVUXGFCFXSKU-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N2O |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 2,6-dichloro-3-phenylquinazolin-4-one |
| InChIKey | HFWVUXGFCFXSKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=C(C=CC(=C3)Cl)N=C2Cl |
Computed by PubChem (NCBI)