CAS 346694-62-0 is the registry number for (1H-Benzo[d]imidazol-1-yl)(2,5-dichlorophenyl)methanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzimidazol-1-yl-(2,5-dichlorophenyl)methanone (CAS 346694-62-0) is a chemical compound with the molecular formula C14H8Cl2N2O and a molecular weight of 291.1 g/mol. IUPAC name: benzimidazol-1-yl-(2,5-dichlorophenyl)methanone. InChIKey: STTVSUZVMUDKQA-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N2O |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | benzimidazol-1-yl-(2,5-dichlorophenyl)methanone |
| InChIKey | STTVSUZVMUDKQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2C(=O)C3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)