CAS 1210365-48-2 is the registry number for 5-Benzyl-1,3-thiazol-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.
5-benzyl-1,3-thiazol-2-amine;hydrochloride (CAS 1210365-48-2) is a chemical compound with the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. IUPAC name: 5-benzyl-1,3-thiazol-2-amine;hydrochloride. InChIKey: ULAQYRGGOOBOLJ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | 5-benzyl-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | ULAQYRGGOOBOLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CN=C(S2)N.Cl |
Computed by PubChem (NCBI)