CAS 1211-19-4 appears in our catalog under these names: SIRT–IN–3, SIRT-IN-3 97%, 2-(Phenylamino)benzamide, 97%, 97%, SIRT-IN-3, 99.12%, 2-(Phenylamino)benzamide, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10mg, 10mM (in 1ml dmso), 250mg, 1g, 5g, 100 mg, 50 mg, 10 mg.
2-anilinobenzamide (CAS 1211-19-4) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: 2-anilinobenzamide. InChIKey: JKWQUMKCVDUICQ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 2-anilinobenzamide |
| InChIKey | JKWQUMKCVDUICQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2C(=O)N |
Computed by PubChem (NCBI)