CAS 1211477-87-0 is the registry number for 2-(1H-Imidazol-1-yl)aniline dihydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-imidazol-1-ylaniline;dihydrochloride (CAS 1211477-87-0) is a chemical compound with the molecular formula C9H11Cl2N3 and a molecular weight of 232.11 g/mol. IUPAC name: 2-imidazol-1-ylaniline;dihydrochloride. InChIKey: GMANGTCLSBAIKQ-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N3 |
|---|---|
| Molecular weight | 232.11 g/mol |
| IUPAC name | 2-imidazol-1-ylaniline;dihydrochloride |
| InChIKey | GMANGTCLSBAIKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)N2C=CN=C2.Cl.Cl |
Computed by PubChem (NCBI)