Products 1211532-95-4
CAS 1211532-95-4 is the registry number for 5H,7H,8H-Pyrano(4,3-b)pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylic acid (CAS 1211532-95-4) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylic acid. InChIKey: BVUCWSYTMXNNEZ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 7,8-dihydro-5H-pyrano[4,3-b]pyridine-2-carboxylic acid |
| InChIKey | BVUCWSYTMXNNEZ-UHFFFAOYSA-N |
| SMILES | C1COCC2=C1N=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)