Products 1211539-93-3

CAS 1211539-93-3 is the registry number for Thieno(3,2-d)pyrimidine-6-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Thieno[3,2-d]pyrimidine-6-carboxylic acid (CAS 1211539-93-3) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: thieno[3,2-d]pyrimidine-6-carboxylic acid. InChIKey: QXKDYVQSQQPDSE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4N2O2S
Molecular weight180.19 g/mol
IUPAC namethieno[3,2-d]pyrimidine-6-carboxylic acid
InChIKeyQXKDYVQSQQPDSE-UHFFFAOYSA-N
SMILESC1=C(SC2=CN=CN=C21)C(=O)O

Computed by PubChem (NCBI)