Products 1211588-66-7
CAS 1211588-66-7 appears in our catalog under these names: 6-(tert-Butyl)-2-chloronicotinic acid, 95%, 95%, 6-(tert-Butyl)-2-chloronicotinic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
6-tert-butyl-2-chloropyridine-3-carboxylic acid (CAS 1211588-66-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 6-tert-butyl-2-chloropyridine-3-carboxylic acid. InChIKey: ISBSSLLKVDMOQI-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 6-tert-butyl-2-chloropyridine-3-carboxylic acid |
| InChIKey | ISBSSLLKVDMOQI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)