CAS 1212977-59-7 appears in our catalog under these names: (S)–2–Amino–2–(3–ethoxy–4–methoxyphenyl)acetic acid, (S)-2-Amino-2-(3-ethoxy-4-methoxyphenyl)acetic acid, 95%, 95%, (S)-2-Amino-2-(3-ethoxy-4-methoxyphenyl)acetic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
(2S)-2-amino-2-(3-ethoxy-4-methoxyphenyl)acetic acid (CAS 1212977-59-7) is a chemical compound with the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. IUPAC name: (2S)-2-amino-2-(3-ethoxy-4-methoxyphenyl)acetic acid. InChIKey: RSHMDDPZZGLVAD-JTQLQIEISA-N.
| Molecular formula | C11H15NO4 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-ethoxy-4-methoxyphenyl)acetic acid |
| InChIKey | RSHMDDPZZGLVAD-JTQLQIEISA-N |
| SMILES | CCOC1=C(C=CC(=C1)[C@@H](C(=O)O)N)OC |
Computed by PubChem (NCBI)