CAS 1213610-31-1 is the registry number for (S)-2-Amino-2-(2,6-difluorophenyl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-2-(2,6-difluorophenyl)acetic acid (CAS 1213610-31-1) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: (2S)-2-amino-2-(2,6-difluorophenyl)acetic acid. InChIKey: UQFQFMHLBQOCLY-ZETCQYMHSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | (2S)-2-amino-2-(2,6-difluorophenyl)acetic acid |
| InChIKey | UQFQFMHLBQOCLY-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[C@@H](C(=O)O)N)F |
Computed by PubChem (NCBI)