CAS 1213925-23-5 is the registry number for (R)-2-Amino-2-(3,5-dibromophenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-2-(3,5-dibromophenyl)acetic acid (CAS 1213925-23-5) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: (2R)-2-amino-2-(3,5-dibromophenyl)acetic acid. InChIKey: GYUYQCXCMZSVKL-SSDOTTSWSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | (2R)-2-amino-2-(3,5-dibromophenyl)acetic acid |
| InChIKey | GYUYQCXCMZSVKL-SSDOTTSWSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)