Products 1214323-04-2
CAS 1214323-04-2 appears in our catalog under these names: 1-(3-Chloro-2-fluorophenyl)propan-1-one, 1-(3-Chloro-2-fluorophenyl)propan-1-one, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
1-(3-chloro-2-fluorophenyl)propan-1-one (CAS 1214323-04-2) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(3-chloro-2-fluorophenyl)propan-1-one. InChIKey: IPTXOGKXXWEFIX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(3-chloro-2-fluorophenyl)propan-1-one |
| InChIKey | IPTXOGKXXWEFIX-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C(=CC=C1)Cl)F |
Computed by PubChem (NCBI)