Products 1214375-24-2
CAS 1214375-24-2 appears in our catalog under these names: Methyl 5，6–dichloropicolinate, Methyl 5,6-dichloropicolinate 97%, Methyl 5,6-dichloropicolinate, 97%, 97%, Methyl 5,6-dichloropicolinate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g, 500g, 50g.
Methyl 5,6-dichloropyridine-2-carboxylate (CAS 1214375-24-2) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: methyl 5,6-dichloropyridine-2-carboxylate. InChIKey: HVVBBQRGDOCRCA-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | methyl 5,6-dichloropyridine-2-carboxylate |
| InChIKey | HVVBBQRGDOCRCA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)