CAS 1214375-74-2 appears in our catalog under these names: Ethyl 2,5-dibromonicotinate 95+%, Ethyl 2,5-dibromonicotinate, 95+%, 95+%, Ethyl 2,5-dibromo-3-pyridinecarboxylate, ≥95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
Ethyl 2,5-dibromopyridine-3-carboxylate (CAS 1214375-74-2) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: ethyl 2,5-dibromopyridine-3-carboxylate. InChIKey: NMPIHOQTXGSWRI-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | ethyl 2,5-dibromopyridine-3-carboxylate |
| InChIKey | NMPIHOQTXGSWRI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)Br)Br |
Computed by PubChem (NCBI)