CAS 176896-72-3 appears in our catalog under these names: H-P-Fluoro-d-phe-ome hydrochloride, 98%, (R)-Methyl 2-amino-3-(4-fluorophenyl)propanoate hydrochloride, 98+%, H–p–Fluoro–D–Phe–OMe · HCl, H-P-FLUORO-D-PHE-OME HCL, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 100g.
Methyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride (CAS 176896-72-3) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride. InChIKey: FHEHCZJLZDLUAW-SBSPUUFOSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride |
| InChIKey | FHEHCZJLZDLUAW-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)