CAS 1215328-08-7 is the registry number for 5-Amino-1-naphthalenesulfonamide Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5g, 250mg.
5-aminonaphthalene-1-sulfonamide;hydrochloride (CAS 1215328-08-7) is a chemical compound with the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. IUPAC name: 5-aminonaphthalene-1-sulfonamide;hydrochloride. InChIKey: WWBOBZDWXGYVDF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2S |
|---|---|
| Molecular weight | 258.73 g/mol |
| IUPAC name | 5-aminonaphthalene-1-sulfonamide;hydrochloride |
| InChIKey | WWBOBZDWXGYVDF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2S(=O)(=O)N)C(=C1)N.Cl |
Computed by PubChem (NCBI)