CAS 181481-30-1 is the registry number for 1-(4-Chlorobenzenesulfonyl)-2-methyl-4,5-dihydro-1h-imidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(4-chlorophenyl)sulfonyl-2-methyl-4,5-dihydroimidazole (CAS 181481-30-1) is a chemical compound with the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonyl-2-methyl-4,5-dihydroimidazole. InChIKey: VGNQTUXQBZIPTO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2S |
|---|---|
| Molecular weight | 258.73 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonyl-2-methyl-4,5-dihydroimidazole |
| InChIKey | VGNQTUXQBZIPTO-UHFFFAOYSA-N |
| SMILES | CC1=NCCN1S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)