CAS 1820581-64-3 appears in our catalog under these names: (2S)-2-Amino-3-(1,3-benzothiazol-2-yl)propanoic acid hydrochloride, 95%, (S)–2–Amino–3–(benzo(d)thiazol–2–yl)propanoic acid hydrochloride, H-Ala(benzo[d]thiazol-2-yl)-OH HCl 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
(2S)-2-amino-3-(1,3-benzothiazol-2-yl)propanoic acid;hydrochloride (CAS 1820581-64-3) is a chemical compound with the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. IUPAC name: (2S)-2-amino-3-(1,3-benzothiazol-2-yl)propanoic acid;hydrochloride. InChIKey: BWLYFKNQAGZYKX-RGMNGODLSA-N.
| Molecular formula | C10H11ClN2O2S |
|---|---|
| Molecular weight | 258.73 g/mol |
| IUPAC name | (2S)-2-amino-3-(1,3-benzothiazol-2-yl)propanoic acid;hydrochloride |
| InChIKey | BWLYFKNQAGZYKX-RGMNGODLSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)