Products 1339217-64-9

CAS 1339217-64-9 appears in our catalog under these names: 1-(Propan-2-yl)-1H-indazole-5-sulfonyl chloride, 95%, 1-(Propan-2-yl)-1H-indazole-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-propan-2-ylindazole-5-sulfonyl chloride (CAS 1339217-64-9) is a chemical compound with the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. IUPAC name: 1-propan-2-ylindazole-5-sulfonyl chloride. InChIKey: NTBBYNIOICLOMP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClN2O2S
Molecular weight258.73 g/mol
IUPAC name1-propan-2-ylindazole-5-sulfonyl chloride
InChIKeyNTBBYNIOICLOMP-UHFFFAOYSA-N
SMILESCC(C)N1C2=C(C=C(C=C2)S(=O)(=O)Cl)C=N1

Computed by PubChem (NCBI)