CAS 299954-05-5 is the registry number for 2-(2-Chloroacetamido)-4H,5H,6H-cyclopenta(b)thiophene-3-carboxamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-[(2-chloroacetyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (CAS 299954-05-5) is a chemical compound with the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. IUPAC name: 2-[(2-chloroacetyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide. InChIKey: ALPHKUSWEDXBQI-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2S |
|---|---|
| Molecular weight | 258.73 g/mol |
| IUPAC name | 2-[(2-chloroacetyl)amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| InChIKey | ALPHKUSWEDXBQI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)N)NC(=O)CCl |
Computed by PubChem (NCBI)