CAS 2193066-97-4 appears in our catalog under these names: 3-[(1,3-benzothiazol-2-yl)amino]propanoic acid hydrochloride, 95%, 3-(Benzo(d)thiazol-2-ylamino)propanoic acid hydrochloride, 98%, 3-((1,3-Benzothiazol-2-yl)amino)propanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-(1,3-benzothiazol-2-ylamino)propanoic acid;hydrochloride (CAS 2193066-97-4) is a chemical compound with the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-ylamino)propanoic acid;hydrochloride. InChIKey: QKHLPZRBCSTHOZ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2S |
|---|---|
| Molecular weight | 258.73 g/mol |
| IUPAC name | 3-(1,3-benzothiazol-2-ylamino)propanoic acid;hydrochloride |
| InChIKey | QKHLPZRBCSTHOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NCCC(=O)O.Cl |
Computed by PubChem (NCBI)