CAS 854357-43-0 appears in our catalog under these names: N-(2-[(2-Amino-2-oxoethyl)thio]phenyl)-2-chloroacetamide, 95%, 2-{(2-(2-chloroacetamido)phenyl)sulfanyl}acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[2-[(2-chloroacetyl)amino]phenyl]sulfanylacetamide (CAS 854357-43-0) is a chemical compound with the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. IUPAC name: 2-[2-[(2-chloroacetyl)amino]phenyl]sulfanylacetamide. InChIKey: QJZCVYHCPSONIO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O2S |
|---|---|
| Molecular weight | 258.73 g/mol |
| IUPAC name | 2-[2-[(2-chloroacetyl)amino]phenyl]sulfanylacetamide |
| InChIKey | QJZCVYHCPSONIO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CCl)SCC(=O)N |
Computed by PubChem (NCBI)