CAS 1215339-86-8 appears in our catalog under these names: 6-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 6-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%, 97%, 6-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g, 10g.
6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1215339-86-8) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: BTTOLFCXRXFGKD-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | BTTOLFCXRXFGKD-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)