Products 2703746-10-3
CAS 2703746-10-3 appears in our catalog under these names: (R)-6-Bromo-2,3-dihydrobenzofuran-3-amine Hydrochloride, 97%, 97%, (R)-6-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(3R)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2703746-10-3) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: (3R)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: BTTOLFCXRXFGKD-FJXQXJEOSA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | (3R)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | BTTOLFCXRXFGKD-FJXQXJEOSA-N |
| SMILES | C1[C@@H](C2=C(O1)C=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)