Products 1216284-09-1
CAS 1216284-09-1 is the registry number for 3-(6,7-Dihydro-5h-pyrrolo[1,2-a]imidazol-3-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)aniline (CAS 1216284-09-1) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)aniline. InChIKey: CKYSIAQDFVGTOX-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)aniline |
| InChIKey | CKYSIAQDFVGTOX-UHFFFAOYSA-N |
| SMILES | C1CC2=NC=C(N2C1)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)